3,3-dimethylbutane-1-sulfonyl fluoride

C6H13FO2S — CID 54593040

IUPAC3,3-dimethylbutane-1-sulfonyl fluoride
SMILESCC(C)(C)CCS(=O)(=O)F
InChIInChI=1S/C6H13FO2S/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3
InChIKeyDYOHYZQXJMQYBZ-UHFFFAOYSA-N
MW168.23 g/mol
LogP1.72
Rot. Bonds2

About 3,3-dimethylbutane-1-sulfonyl fluoride

3,3-dimethylbutane-1-sulfonyl fluoride (PubChem CID 54593040) has the molecular formula C6H13FO2S and a molecular weight of 168.23 g/mol. Its IUPAC name is 3,3-dimethylbutane-1-sulfonyl fluoride.

Molecular Properties

Compound Name3,3-dimethylbutane-1-sulfonyl fluoride
PubChem CID54593040
Molecular FormulaC6H13FO2S
Molecular Weight168.23 g/mol
Exact Mass168.06
IUPAC Name3,3-dimethylbutane-1-sulfonyl fluoride
SMILESCC(C)(C)CCS(=O)(=O)F
InChIInChI=1S/C6H13FO2S/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3
InChIKeyDYOHYZQXJMQYBZ-UHFFFAOYSA-N
XLogP1.72
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.23
LogP ≤ 51.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 3,3-dimethylbutane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylbutane-1-sulfonyl fluoride?
The IUPAC name of 3,3-dimethylbutane-1-sulfonyl fluoride (CID 54593040) is 3,3-dimethylbutane-1-sulfonyl fluoride.
What is the SMILES notation for 3,3-dimethylbutane-1-sulfonyl fluoride?
The canonical SMILES for 3,3-dimethylbutane-1-sulfonyl fluoride is CC(C)(C)CCS(=O)(=O)F.
What is the InChIKey of 3,3-dimethylbutane-1-sulfonyl fluoride?
The InChIKey is DYOHYZQXJMQYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FO2S/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3.
What are the key properties of 3,3-dimethylbutane-1-sulfonyl fluoride?
3,3-dimethylbutane-1-sulfonyl fluoride has a molecular weight of 168.23 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutane-1-sulfonyl fluoride is sourced from PubChem (CID 54593040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).