About 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile
2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile (PubChem CID 54593057) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile |
| PubChem CID | 54593057 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile |
| SMILES | CC1(C)C(=O)NC(=O)N1CC#N |
| InChI | InChI=1S/C7H9N3O2/c1-7(2)5(11)9-6(12)10(7)4-3-8/h4H2,1-2H3,(H,9,11,12) |
| InChIKey | ZPPPTNFEUBIOKO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile?
The IUPAC name of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile (CID 54593057) is 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile.
What is the SMILES notation for 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile?
The canonical SMILES for 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile is CC1(C)C(=O)NC(=O)N1CC#N.
What is the InChIKey of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile?
The InChIKey is ZPPPTNFEUBIOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-7(2)5(11)9-6(12)10(7)4-3-8/h4H2,1-2H3,(H,9,11,12).
What are the key properties of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile?
2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile has a molecular weight of 167.17 g/mol, XLogP of -0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetonitrile is sourced from PubChem (CID 54593057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).