C17H34N2O2 — CID 54593220
tert-butyl N-(4,4-dimethyl-2-piperidin-2-ylpentyl)carbamate (PubChem CID 54593220) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is tert-butyl N-(4,4-dimethyl-2-piperidin-2-ylpentyl)carbamate.
| Compound Name | tert-butyl N-(4,4-dimethyl-2-piperidin-2-ylpentyl)carbamate |
|---|---|
| PubChem CID | 54593220 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | tert-butyl N-(4,4-dimethyl-2-piperidin-2-ylpentyl)carbamate |
| SMILES | CC(C)(C)CC(CNC(=O)OC(C)(C)C)C1CCCCN1 |
| InChI | InChI=1S/C17H34N2O2/c1-16(2,3)11-13(14-9-7-8-10-18-14)12-19-15(20)21-17(4,5)6/h13-14,18H,7-12H2,1-6H3,(H,19,20) |
| InChIKey | KIMAVXXQFVORIO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |