About 5-pyrazol-1-ylpyrimidine
5-pyrazol-1-ylpyrimidine (PubChem CID 54593304) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-pyrazol-1-ylpyrimidine.
Molecular Properties
| Compound Name | 5-pyrazol-1-ylpyrimidine |
| PubChem CID | 54593304 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 5-pyrazol-1-ylpyrimidine |
| SMILES | c1cnn(-c2cncnc2)c1 |
| InChI | InChI=1S/C7H6N4/c1-2-10-11(3-1)7-4-8-6-9-5-7/h1-6H |
| InChIKey | CVBQUPDAGIPUBD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyrazol-1-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazol-1-ylpyrimidine?
The IUPAC name of 5-pyrazol-1-ylpyrimidine (CID 54593304) is 5-pyrazol-1-ylpyrimidine.
What is the SMILES notation for 5-pyrazol-1-ylpyrimidine?
The canonical SMILES for 5-pyrazol-1-ylpyrimidine is c1cnn(-c2cncnc2)c1.
What is the InChIKey of 5-pyrazol-1-ylpyrimidine?
The InChIKey is CVBQUPDAGIPUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-2-10-11(3-1)7-4-8-6-9-5-7/h1-6H.
What are the key properties of 5-pyrazol-1-ylpyrimidine?
5-pyrazol-1-ylpyrimidine has a molecular weight of 146.15 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazol-1-ylpyrimidine is sourced from PubChem (CID 54593304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).