About [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide
[(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide (PubChem CID 5459342) has the molecular formula C13H21IN2
and a molecular weight of 332.23 g/mol. Its IUPAC name is [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide |
| PubChem CID | 5459342 |
| Molecular Formula | C13H21IN2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide |
| SMILES | C/C(=N\[N+](C)(C)C)c1ccc(C)c(C)c1.[I-] |
| InChI | InChI=1S/C13H21N2.HI/c1-10-7-8-13(9-11(10)2)12(3)14-15(4,5)6;/h7-9H,1-6H3;1H/q+1;/p-1/b14-12+; |
| InChIKey | LQJUEFUDAGGIOP-UNGNXWFZSA-M |
| XLogP | -0.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide?
The IUPAC name of [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide (CID 5459342) is [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide.
What is the SMILES notation for [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide?
The canonical SMILES for [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide is C/C(=N\[N+](C)(C)C)c1ccc(C)c(C)c1.[I-].
What is the InChIKey of [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide?
The InChIKey is LQJUEFUDAGGIOP-UNGNXWFZSA-M. The full InChI is InChI=1S/C13H21N2.HI/c1-10-7-8-13(9-11(10)2)12(3)14-15(4,5)6;/h7-9H,1-6H3;1H/q+1;/p-1/b14-12+;.
What are the key properties of [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide?
[(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide has a molecular weight of 332.23 g/mol, XLogP of -0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(3,4-dimethylphenyl)ethylideneamino]-trimethylazanium iodide is sourced from PubChem (CID 5459342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).