About 4-amino-1,1-diphosphonatobutan-1-ol
4-amino-1,1-diphosphonatobutan-1-ol (PubChem CID 5459353) has the molecular formula C4H9NO7P2-4
and a molecular weight of 245.06 g/mol. Its IUPAC name is 4-amino-1,1-diphosphonatobutan-1-ol.
Molecular Properties
| Compound Name | 4-amino-1,1-diphosphonatobutan-1-ol |
| PubChem CID | 5459353 |
| Molecular Formula | C4H9NO7P2-4 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 4-amino-1,1-diphosphonatobutan-1-ol |
| SMILES | NCCCC(O)(P(=O)([O-])[O-])P(=O)([O-])[O-] |
| InChI | InChI=1S/C4H13NO7P2/c5-3-1-2-4(6,13(7,8)9)14(10,11)12/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12)/p-4 |
| InChIKey | OGSPWJRAVKPPFI-UHFFFAOYSA-J |
| XLogP | -3.80 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,1-diphosphonatobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,1-diphosphonatobutan-1-ol?
The IUPAC name of 4-amino-1,1-diphosphonatobutan-1-ol (CID 5459353) is 4-amino-1,1-diphosphonatobutan-1-ol.
What is the SMILES notation for 4-amino-1,1-diphosphonatobutan-1-ol?
The canonical SMILES for 4-amino-1,1-diphosphonatobutan-1-ol is NCCCC(O)(P(=O)([O-])[O-])P(=O)([O-])[O-].
What is the InChIKey of 4-amino-1,1-diphosphonatobutan-1-ol?
The InChIKey is OGSPWJRAVKPPFI-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H13NO7P2/c5-3-1-2-4(6,13(7,8)9)14(10,11)12/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12)/p-4.
What are the key properties of 4-amino-1,1-diphosphonatobutan-1-ol?
4-amino-1,1-diphosphonatobutan-1-ol has a molecular weight of 245.06 g/mol, XLogP of -3.80, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,1-diphosphonatobutan-1-ol is sourced from PubChem (CID 5459353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).