C9H14NO7P — CID 5459371
[(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] dihydrogen phosphate (PubChem CID 5459371) has the molecular formula C9H14NO7P and a molecular weight of 279.19 g/mol. Its IUPAC name is [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] dihydrogen phosphate.
| Compound Name | [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 5459371 |
| Molecular Formula | C9H14NO7P |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@@H](O)[C@@H](O)Nc1ccccc1O |
| InChI | InChI=1S/C9H14NO7P/c11-7-4-2-1-3-6(7)10-9(13)8(12)5-17-18(14,15)16/h1-4,8-13H,5H2,(H2,14,15,16)/t8-,9-/m1/s1 |
| InChIKey | SPOVITMZOKMJPQ-RKDXNWHRSA-N |
| XLogP | -0.41 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|