About 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide
2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide (PubChem CID 54593779) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide |
| PubChem CID | 54593779 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(C)C(=O)NC(=O)N1CC(N)=O |
| InChI | InChI=1S/C7H11N3O3/c1-7(2)5(12)9-6(13)10(7)3-4(8)11/h3H2,1-2H3,(H2,8,11)(H,9,12,13) |
| InChIKey | NOQCJLXBVDNVFG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide?
The IUPAC name of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide (CID 54593779) is 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide.
What is the SMILES notation for 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide?
The canonical SMILES for 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide is CC1(C)C(=O)NC(=O)N1CC(N)=O.
What is the InChIKey of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide?
The InChIKey is NOQCJLXBVDNVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-7(2)5(12)9-6(13)10(7)3-4(8)11/h3H2,1-2H3,(H2,8,11)(H,9,12,13).
What are the key properties of 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide?
2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide has a molecular weight of 185.18 g/mol, XLogP of -1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide is sourced from PubChem (CID 54593779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).