About 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide
4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide (PubChem CID 54593862) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide |
| PubChem CID | 54593862 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCn1ccc(N)n1 |
| InChI | InChI=1S/C9H16N4O/c1-12(2)9(14)4-3-6-13-7-5-8(10)11-13/h5,7H,3-4,6H2,1-2H3,(H2,10,11) |
| InChIKey | PFWCDVKDFGCVGU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide?
The IUPAC name of 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide (CID 54593862) is 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide.
What is the SMILES notation for 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide?
The canonical SMILES for 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide is CN(C)C(=O)CCCn1ccc(N)n1.
What is the InChIKey of 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide?
The InChIKey is PFWCDVKDFGCVGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-12(2)9(14)4-3-6-13-7-5-8(10)11-13/h5,7H,3-4,6H2,1-2H3,(H2,10,11).
What are the key properties of 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide?
4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide has a molecular weight of 196.25 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminopyrazol-1-yl)-N,N-dimethylbutanamide is sourced from PubChem (CID 54593862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).