C6H5N3O2S2 — CID 54593922
5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid (PubChem CID 54593922) has the molecular formula C6H5N3O2S2 and a molecular weight of 215.26 g/mol. Its IUPAC name is 5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid.
| Compound Name | 5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid |
|---|---|
| PubChem CID | 54593922 |
| Molecular Formula | C6H5N3O2S2 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2n[nH]c(=S)n12 |
| InChI | InChI=1S/C6H5N3O2S2/c1-2-3(4(10)11)13-6-8-7-5(12)9(2)6/h1H3,(H,7,12)(H,10,11) |
| InChIKey | RVHKKUGGPFYLAX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|