About N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide
N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide (PubChem CID 54593964) has the molecular formula C10H18Br2N4
and a molecular weight of 354.09 g/mol. Its IUPAC name is N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide.
Molecular Properties
| Compound Name | N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide |
| PubChem CID | 54593964 |
| Molecular Formula | C10H18Br2N4 |
| Molecular Weight | 354.09 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide |
| SMILES | Br.Br.CN(c1cccnn1)C1CCNCC1 |
| InChI | InChI=1S/C10H16N4.2BrH/c1-14(9-4-7-11-8-5-9)10-3-2-6-12-13-10;;/h2-3,6,9,11H,4-5,7-8H2,1H3;2*1H |
| InChIKey | VSOMNNOADTWOHJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide?
The IUPAC name of N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide (CID 54593964) is N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide.
What is the SMILES notation for N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide?
The canonical SMILES for N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide is Br.Br.CN(c1cccnn1)C1CCNCC1.
What is the InChIKey of N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide?
The InChIKey is VSOMNNOADTWOHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4.2BrH/c1-14(9-4-7-11-8-5-9)10-3-2-6-12-13-10;;/h2-3,6,9,11H,4-5,7-8H2,1H3;2*1H.
What are the key properties of N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide?
N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide has a molecular weight of 354.09 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-piperidin-4-ylpyridazin-3-amine;dihydrobromide is sourced from PubChem (CID 54593964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).