About 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride
1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride (PubChem CID 54594116) has the molecular formula C5H7ClN2OS
and a molecular weight of 178.64 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride |
| PubChem CID | 54594116 |
| Molecular Formula | C5H7ClN2OS |
| Molecular Weight | 178.64 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride |
| SMILES | CC(=O)c1cnc(N)s1.Cl |
| InChI | InChI=1S/C5H6N2OS.ClH/c1-3(8)4-2-7-5(6)9-4;/h2H,1H3,(H2,6,7);1H |
| InChIKey | HUFIQVKVOIZQDF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride?
The IUPAC name of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride (CID 54594116) is 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride.
What is the SMILES notation for 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride?
The canonical SMILES for 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride is CC(=O)c1cnc(N)s1.Cl.
What is the InChIKey of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride?
The InChIKey is HUFIQVKVOIZQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS.ClH/c1-3(8)4-2-7-5(6)9-4;/h2H,1H3,(H2,6,7);1H.
What are the key properties of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride?
1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride has a molecular weight of 178.64 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrochloride is sourced from PubChem (CID 54594116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).