About 2-(diethylamino)butanoic acid;hydrochloride
2-(diethylamino)butanoic acid;hydrochloride (PubChem CID 54594122) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is 2-(diethylamino)butanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)butanoic acid;hydrochloride |
| PubChem CID | 54594122 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(diethylamino)butanoic acid;hydrochloride |
| SMILES | CCC(C(=O)O)N(CC)CC.Cl |
| InChI | InChI=1S/C8H17NO2.ClH/c1-4-7(8(10)11)9(5-2)6-3;/h7H,4-6H2,1-3H3,(H,10,11);1H |
| InChIKey | LKVZCYZTPHWNIA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)butanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)butanoic acid;hydrochloride?
The IUPAC name of 2-(diethylamino)butanoic acid;hydrochloride (CID 54594122) is 2-(diethylamino)butanoic acid;hydrochloride.
What is the SMILES notation for 2-(diethylamino)butanoic acid;hydrochloride?
The canonical SMILES for 2-(diethylamino)butanoic acid;hydrochloride is CCC(C(=O)O)N(CC)CC.Cl.
What is the InChIKey of 2-(diethylamino)butanoic acid;hydrochloride?
The InChIKey is LKVZCYZTPHWNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.ClH/c1-4-7(8(10)11)9(5-2)6-3;/h7H,4-6H2,1-3H3,(H,10,11);1H.
What are the key properties of 2-(diethylamino)butanoic acid;hydrochloride?
2-(diethylamino)butanoic acid;hydrochloride has a molecular weight of 195.69 g/mol, XLogP of 1.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)butanoic acid;hydrochloride is sourced from PubChem (CID 54594122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).