About 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione
2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione (PubChem CID 54594145) has the molecular formula C12H8N4S
and a molecular weight of 240.29 g/mol. Its IUPAC name is 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione.
Molecular Properties
| Compound Name | 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione |
| PubChem CID | 54594145 |
| Molecular Formula | C12H8N4S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione |
| SMILES | S=c1nc[nH]c2nc(-c3ccccc3)ncc12 |
| InChI | InChI=1S/C12H8N4S/c17-12-9-6-13-10(8-4-2-1-3-5-8)16-11(9)14-7-15-12/h1-7H,(H,13,14,15,16,17) |
| InChIKey | INOQSYITPPQBTI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione?
The IUPAC name of 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione (CID 54594145) is 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione.
What is the SMILES notation for 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione?
The canonical SMILES for 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione is S=c1nc[nH]c2nc(-c3ccccc3)ncc12.
What is the InChIKey of 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione?
The InChIKey is INOQSYITPPQBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4S/c17-12-9-6-13-10(8-4-2-1-3-5-8)16-11(9)14-7-15-12/h1-7H,(H,13,14,15,16,17).
What are the key properties of 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione?
2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione has a molecular weight of 240.29 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-8H-pyrimido[4,5-d]pyrimidine-5-thione is sourced from PubChem (CID 54594145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).