C9H11ClN2 — CID 54594249
6-chloro-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 54594249) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 6-chloro-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 6-chloro-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 54594249 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 6-chloro-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | NC1CCNc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H11ClN2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5,8,12H,3-4,11H2 |
| InChIKey | OXOPPJOJMLUEHH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |