About 4-methyl-2,3-dihydrofuro[2,3-b]quinoline
4-methyl-2,3-dihydrofuro[2,3-b]quinoline (PubChem CID 5459433) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-methyl-2,3-dihydrofuro[2,3-b]quinoline.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydrofuro[2,3-b]quinoline |
| PubChem CID | 5459433 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-methyl-2,3-dihydrofuro[2,3-b]quinoline |
| SMILES | Cc1c2c(nc3ccccc13)OCC2 |
| InChI | InChI=1S/C12H11NO/c1-8-9-4-2-3-5-11(9)13-12-10(8)6-7-14-12/h2-5H,6-7H2,1H3 |
| InChIKey | BGVLSDUMLSASEB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,3-dihydrofuro[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydrofuro[2,3-b]quinoline?
The IUPAC name of 4-methyl-2,3-dihydrofuro[2,3-b]quinoline (CID 5459433) is 4-methyl-2,3-dihydrofuro[2,3-b]quinoline.
What is the SMILES notation for 4-methyl-2,3-dihydrofuro[2,3-b]quinoline?
The canonical SMILES for 4-methyl-2,3-dihydrofuro[2,3-b]quinoline is Cc1c2c(nc3ccccc13)OCC2.
What is the InChIKey of 4-methyl-2,3-dihydrofuro[2,3-b]quinoline?
The InChIKey is BGVLSDUMLSASEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-8-9-4-2-3-5-11(9)13-12-10(8)6-7-14-12/h2-5H,6-7H2,1H3.
What are the key properties of 4-methyl-2,3-dihydrofuro[2,3-b]quinoline?
4-methyl-2,3-dihydrofuro[2,3-b]quinoline has a molecular weight of 185.23 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydrofuro[2,3-b]quinoline is sourced from PubChem (CID 5459433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).