About 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine
3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine (PubChem CID 54594401) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine |
| PubChem CID | 54594401 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine |
| SMILES | CCc1ccc(C2NCC(C)OC2C)o1 |
| InChI | InChI=1S/C12H19NO2/c1-4-10-5-6-11(15-10)12-9(3)14-8(2)7-13-12/h5-6,8-9,12-13H,4,7H2,1-3H3 |
| InChIKey | ZKMFNBKTKXOQST-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine?
The IUPAC name of 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine (CID 54594401) is 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine.
What is the SMILES notation for 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine?
The canonical SMILES for 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine is CCc1ccc(C2NCC(C)OC2C)o1.
What is the InChIKey of 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine?
The InChIKey is ZKMFNBKTKXOQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-4-10-5-6-11(15-10)12-9(3)14-8(2)7-13-12/h5-6,8-9,12-13H,4,7H2,1-3H3.
What are the key properties of 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine?
3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine has a molecular weight of 209.29 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethylfuran-2-yl)-2,6-dimethylmorpholine is sourced from PubChem (CID 54594401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).