C10H15NO — CID 54594405
2-(2,5-dimethylfuran-3-yl)pyrrolidine (PubChem CID 54594405) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-(2,5-dimethylfuran-3-yl)pyrrolidine.
| Compound Name | 2-(2,5-dimethylfuran-3-yl)pyrrolidine |
|---|---|
| PubChem CID | 54594405 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-(2,5-dimethylfuran-3-yl)pyrrolidine |
| SMILES | Cc1cc(C2CCCN2)c(C)o1 |
| InChI | InChI=1S/C10H15NO/c1-7-6-9(8(2)12-7)10-4-3-5-11-10/h6,10-11H,3-5H2,1-2H3 |
| InChIKey | MVVFMVHHCJPTOQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |