1,2-oxazol-3-ylmethanesulfonyl chloride

C4H4ClNO3S — CID 54594458

IUPAC1,2-oxazol-3-ylmethanesulfonyl chloride
SMILESO=S(=O)(Cl)Cc1ccon1
InChIInChI=1S/C4H4ClNO3S/c5-10(7,8)3-4-1-2-9-6-4/h1-2H,3H2
InChIKeyLZJDCFQEMYUREM-UHFFFAOYSA-N
MW181.60 g/mol
LogP0.74
Rot. Bonds2

About 1,2-oxazol-3-ylmethanesulfonyl chloride

1,2-oxazol-3-ylmethanesulfonyl chloride (PubChem CID 54594458) has the molecular formula C4H4ClNO3S and a molecular weight of 181.60 g/mol. Its IUPAC name is 1,2-oxazol-3-ylmethanesulfonyl chloride.

Molecular Properties

Compound Name1,2-oxazol-3-ylmethanesulfonyl chloride
PubChem CID54594458
Molecular FormulaC4H4ClNO3S
Molecular Weight181.60 g/mol
Exact Mass180.96
IUPAC Name1,2-oxazol-3-ylmethanesulfonyl chloride
SMILESO=S(=O)(Cl)Cc1ccon1
InChIInChI=1S/C4H4ClNO3S/c5-10(7,8)3-4-1-2-9-6-4/h1-2H,3H2
InChIKeyLZJDCFQEMYUREM-UHFFFAOYSA-N
XLogP0.74
TPSA60.17 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.60
LogP ≤ 50.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,2-oxazol-3-ylmethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-oxazol-3-ylmethanesulfonyl chloride?
The IUPAC name of 1,2-oxazol-3-ylmethanesulfonyl chloride (CID 54594458) is 1,2-oxazol-3-ylmethanesulfonyl chloride.
What is the SMILES notation for 1,2-oxazol-3-ylmethanesulfonyl chloride?
The canonical SMILES for 1,2-oxazol-3-ylmethanesulfonyl chloride is O=S(=O)(Cl)Cc1ccon1.
What is the InChIKey of 1,2-oxazol-3-ylmethanesulfonyl chloride?
The InChIKey is LZJDCFQEMYUREM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNO3S/c5-10(7,8)3-4-1-2-9-6-4/h1-2H,3H2.
What are the key properties of 1,2-oxazol-3-ylmethanesulfonyl chloride?
1,2-oxazol-3-ylmethanesulfonyl chloride has a molecular weight of 181.60 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazol-3-ylmethanesulfonyl chloride is sourced from PubChem (CID 54594458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).