C15H23BO5S — CID 54594668
4,4,5,5-tetramethyl-2-[4-(2-methylsulfonylethoxy)phenyl]-1,3,2-dioxaborolane (PubChem CID 54594668) has the molecular formula C15H23BO5S and a molecular weight of 326.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(2-methylsulfonylethoxy)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(2-methylsulfonylethoxy)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 54594668 |
| Molecular Formula | C15H23BO5S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(2-methylsulfonylethoxy)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(OCCS(C)(=O)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C15H23BO5S/c1-14(2)15(3,4)21-16(20-14)12-6-8-13(9-7-12)19-10-11-22(5,17)18/h6-9H,10-11H2,1-5H3 |
| InChIKey | JTXDKTGHHLUOCW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|