About (5-amino-2,4-dimethylphenyl)methanol
(5-amino-2,4-dimethylphenyl)methanol (PubChem CID 54594922) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (5-amino-2,4-dimethylphenyl)methanol.
Molecular Properties
| Compound Name | (5-amino-2,4-dimethylphenyl)methanol |
| PubChem CID | 54594922 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (5-amino-2,4-dimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(CO)cc1N |
| InChI | InChI=1S/C9H13NO/c1-6-3-7(2)9(10)4-8(6)5-11/h3-4,11H,5,10H2,1-2H3 |
| InChIKey | HBSAEXCWLRAGJP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-2,4-dimethylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-2,4-dimethylphenyl)methanol?
The IUPAC name of (5-amino-2,4-dimethylphenyl)methanol (CID 54594922) is (5-amino-2,4-dimethylphenyl)methanol.
What is the SMILES notation for (5-amino-2,4-dimethylphenyl)methanol?
The canonical SMILES for (5-amino-2,4-dimethylphenyl)methanol is Cc1cc(C)c(CO)cc1N.
What is the InChIKey of (5-amino-2,4-dimethylphenyl)methanol?
The InChIKey is HBSAEXCWLRAGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-3-7(2)9(10)4-8(6)5-11/h3-4,11H,5,10H2,1-2H3.
What are the key properties of (5-amino-2,4-dimethylphenyl)methanol?
(5-amino-2,4-dimethylphenyl)methanol has a molecular weight of 151.21 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-2,4-dimethylphenyl)methanol is sourced from PubChem (CID 54594922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).