About 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine
2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine (PubChem CID 54595069) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine |
| PubChem CID | 54595069 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine |
| SMILES | COc1cc(CCN)c(SC)cc1OC |
| InChI | InChI=1S/C11H17NO2S/c1-13-9-6-8(4-5-12)11(15-3)7-10(9)14-2/h6-7H,4-5,12H2,1-3H3 |
| InChIKey | CBUXOWVOGMKBMB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine?
The IUPAC name of 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine (CID 54595069) is 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine.
What is the SMILES notation for 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine?
The canonical SMILES for 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine is COc1cc(CCN)c(SC)cc1OC.
What is the InChIKey of 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine?
The InChIKey is CBUXOWVOGMKBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-13-9-6-8(4-5-12)11(15-3)7-10(9)14-2/h6-7H,4-5,12H2,1-3H3.
What are the key properties of 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine?
2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine has a molecular weight of 227.33 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-methylsulfanylphenyl)ethanamine is sourced from PubChem (CID 54595069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).