C13H18O3 — CID 54595110
[5-methyl-2-(oxolan-3-ylmethoxy)phenyl]methanol (PubChem CID 54595110) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is [5-methyl-2-(oxolan-3-ylmethoxy)phenyl]methanol.
| Compound Name | [5-methyl-2-(oxolan-3-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 54595110 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | [5-methyl-2-(oxolan-3-ylmethoxy)phenyl]methanol |
| SMILES | Cc1ccc(OCC2CCOC2)c(CO)c1 |
| InChI | InChI=1S/C13H18O3/c1-10-2-3-13(12(6-10)7-14)16-9-11-4-5-15-8-11/h2-3,6,11,14H,4-5,7-9H2,1H3 |
| InChIKey | ARMPBKCXEDXYII-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |