4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid

C10H9N3O2 — CID 54595205

IUPAC4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid
SMILESCc1nc(-c2ccc(C(=O)O)cc2)n[nH]1
InChIInChI=1S/C10H9N3O2/c1-6-11-9(13-12-6)7-2-4-8(5-3-7)10(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)
InChIKeyLBLKYLOSXMVJQJ-UHFFFAOYSA-N
MW203.20 g/mol
LogP1.48
Rot. Bonds2

About 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid

4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid (PubChem CID 54595205) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid.

Molecular Properties

Compound Name4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid
PubChem CID54595205
Molecular FormulaC10H9N3O2
Molecular Weight203.20 g/mol
Exact Mass203.07
IUPAC Name4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid
SMILESCc1nc(-c2ccc(C(=O)O)cc2)n[nH]1
InChIInChI=1S/C10H9N3O2/c1-6-11-9(13-12-6)7-2-4-8(5-3-7)10(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)
InChIKeyLBLKYLOSXMVJQJ-UHFFFAOYSA-N
XLogP1.48
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 51.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid?
The IUPAC name of 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid (CID 54595205) is 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid.
What is the SMILES notation for 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid?
The canonical SMILES for 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid is Cc1nc(-c2ccc(C(=O)O)cc2)n[nH]1.
What is the InChIKey of 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid?
The InChIKey is LBLKYLOSXMVJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-6-11-9(13-12-6)7-2-4-8(5-3-7)10(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13).
What are the key properties of 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid?
4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid has a molecular weight of 203.20 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1H-1,2,4-triazol-3-yl)benzoic acid is sourced from PubChem (CID 54595205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).