C36H36N2O5 — CID 5459526
methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-[(4-phenylphenyl)methylamino]pent-2-enyl]benzoate (PubChem CID 5459526) has the molecular formula C36H36N2O5 and a molecular weight of 576.69 g/mol. Its IUPAC name is methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-[(4-phenylphenyl)methylamino]pent-2-enyl]benzoate.
| Compound Name | methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-[(4-phenylphenyl)methylamino]pent-2-enyl]benzoate |
|---|---|
| PubChem CID | 5459526 |
| Molecular Formula | C36H36N2O5 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-[(4-phenylphenyl)methylamino]pent-2-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C(NC(=O)OCc2ccccc2)/C(C)=C/[C@@H](C)C(=O)NCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H36N2O5/c1-25(22-26(2)34(39)37-23-27-14-16-30(17-15-27)29-12-8-5-9-13-29)33(31-18-20-32(21-19-31)35(40)42-3)38-36(41)43-24-28-10-6-4-7-11-28/h4-22,26,33H,23-24H2,1-3H3,(H,37,39)(H,38,41)/b25-22+/t26-,33?/m1/s1 |
| InChIKey | ZYJZLAXVSMTILY-AGTZDRRXSA-N |
| XLogP | 7.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|