About 3-(1-isocyanatoethyl)-2,5-dimethylfuran
3-(1-isocyanatoethyl)-2,5-dimethylfuran (PubChem CID 54595275) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-(1-isocyanatoethyl)-2,5-dimethylfuran.
Molecular Properties
| Compound Name | 3-(1-isocyanatoethyl)-2,5-dimethylfuran |
| PubChem CID | 54595275 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-(1-isocyanatoethyl)-2,5-dimethylfuran |
| SMILES | Cc1cc(C(C)N=C=O)c(C)o1 |
| InChI | InChI=1S/C9H11NO2/c1-6-4-9(8(3)12-6)7(2)10-5-11/h4,7H,1-3H3 |
| InChIKey | LTUANKOTZLSCIH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-isocyanatoethyl)-2,5-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-isocyanatoethyl)-2,5-dimethylfuran?
The IUPAC name of 3-(1-isocyanatoethyl)-2,5-dimethylfuran (CID 54595275) is 3-(1-isocyanatoethyl)-2,5-dimethylfuran.
What is the SMILES notation for 3-(1-isocyanatoethyl)-2,5-dimethylfuran?
The canonical SMILES for 3-(1-isocyanatoethyl)-2,5-dimethylfuran is Cc1cc(C(C)N=C=O)c(C)o1.
What is the InChIKey of 3-(1-isocyanatoethyl)-2,5-dimethylfuran?
The InChIKey is LTUANKOTZLSCIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-4-9(8(3)12-6)7(2)10-5-11/h4,7H,1-3H3.
What are the key properties of 3-(1-isocyanatoethyl)-2,5-dimethylfuran?
3-(1-isocyanatoethyl)-2,5-dimethylfuran has a molecular weight of 165.19 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-isocyanatoethyl)-2,5-dimethylfuran is sourced from PubChem (CID 54595275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).