2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid

C5H8F3NO3 — CID 54595326

IUPAC2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid
SMILESNCC(OCC(=O)O)C(F)(F)F
InChIInChI=1S/C5H8F3NO3/c6-5(7,8)3(1-9)12-2-4(10)11/h3H,1-2,9H2,(H,10,11)
InChIKeyCORHSPNAMKSFPB-UHFFFAOYSA-N
MW187.12 g/mol
LogP-0.02
Rot. Bonds4

About 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid

2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid (PubChem CID 54595326) has the molecular formula C5H8F3NO3 and a molecular weight of 187.12 g/mol. Its IUPAC name is 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid.

Molecular Properties

Compound Name2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid
PubChem CID54595326
Molecular FormulaC5H8F3NO3
Molecular Weight187.12 g/mol
Exact Mass187.05
IUPAC Name2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid
SMILESNCC(OCC(=O)O)C(F)(F)F
InChIInChI=1S/C5H8F3NO3/c6-5(7,8)3(1-9)12-2-4(10)11/h3H,1-2,9H2,(H,10,11)
InChIKeyCORHSPNAMKSFPB-UHFFFAOYSA-N
XLogP-0.02
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.12
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid?
The IUPAC name of 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid (CID 54595326) is 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid.
What is the SMILES notation for 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid?
The canonical SMILES for 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid is NCC(OCC(=O)O)C(F)(F)F.
What is the InChIKey of 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid?
The InChIKey is CORHSPNAMKSFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO3/c6-5(7,8)3(1-9)12-2-4(10)11/h3H,1-2,9H2,(H,10,11).
What are the key properties of 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid?
2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid has a molecular weight of 187.12 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,1,1-trifluoropropan-2-yl)oxyacetic acid is sourced from PubChem (CID 54595326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).