About 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride
2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride (PubChem CID 54595327) has the molecular formula C6H11ClF3NO3
and a molecular weight of 237.60 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride |
| PubChem CID | 54595327 |
| Molecular Formula | C6H11ClF3NO3 |
| Molecular Weight | 237.60 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride |
| SMILES | Cl.NCC(COCC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO3.ClH/c7-6(8,9)4(1-10)2-13-3-5(11)12;/h4H,1-3,10H2,(H,11,12);1H |
| InChIKey | VESFDFQFCPFTNA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.60 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride?
The IUPAC name of 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride (CID 54595327) is 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride.
What is the SMILES notation for 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride?
The canonical SMILES for 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride is Cl.NCC(COCC(=O)O)C(F)(F)F.
What is the InChIKey of 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride?
The InChIKey is VESFDFQFCPFTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO3.ClH/c7-6(8,9)4(1-10)2-13-3-5(11)12;/h4H,1-3,10H2,(H,11,12);1H.
What are the key properties of 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride?
2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride has a molecular weight of 237.60 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-3,3,3-trifluoropropoxy]acetic acid;hydrochloride is sourced from PubChem (CID 54595327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).