About 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride
4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride (PubChem CID 54595382) has the molecular formula C12H9ClF2O3S
and a molecular weight of 306.72 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride |
| PubChem CID | 54595382 |
| Molecular Formula | C12H9ClF2O3S |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(OCC(F)F)c2ccccc12 |
| InChI | InChI=1S/C12H9ClF2O3S/c13-19(16,17)11-6-5-10(18-7-12(14)15)8-3-1-2-4-9(8)11/h1-6,12H,7H2 |
| InChIKey | ALAUBQGSEIFBNW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride?
The IUPAC name of 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride (CID 54595382) is 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride.
What is the SMILES notation for 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride?
The canonical SMILES for 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride is O=S(=O)(Cl)c1ccc(OCC(F)F)c2ccccc12.
What is the InChIKey of 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride?
The InChIKey is ALAUBQGSEIFBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF2O3S/c13-19(16,17)11-6-5-10(18-7-12(14)15)8-3-1-2-4-9(8)11/h1-6,12H,7H2.
What are the key properties of 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride?
4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride has a molecular weight of 306.72 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)naphthalene-1-sulfonyl chloride is sourced from PubChem (CID 54595382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).