C29H31N3O5 — CID 5459546
methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-(pyridin-3-ylmethylamino)pent-2-enyl]benzoate (PubChem CID 5459546) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-(pyridin-3-ylmethylamino)pent-2-enyl]benzoate.
| Compound Name | methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-(pyridin-3-ylmethylamino)pent-2-enyl]benzoate |
|---|---|
| PubChem CID | 5459546 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | methyl 4-[(E,4R)-2,4-dimethyl-5-oxo-1-(phenylmethoxycarbonylamino)-5-(pyridin-3-ylmethylamino)pent-2-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C(NC(=O)OCc2ccccc2)/C(C)=C/[C@@H](C)C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C29H31N3O5/c1-20(16-21(2)27(33)31-18-23-10-7-15-30-17-23)26(24-11-13-25(14-12-24)28(34)36-3)32-29(35)37-19-22-8-5-4-6-9-22/h4-17,21,26H,18-19H2,1-3H3,(H,31,33)(H,32,35)/b20-16+/t21-,26?/m1/s1 |
| InChIKey | DRBUWERQZPLXTR-QDYXXAAOSA-N |
| XLogP | 4.73 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|