2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid

C7H8N2O2S — CID 54595590

IUPAC2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(NC2CC2)s1
InChIInChI=1S/C7H8N2O2S/c10-6(11)5-3-8-7(12-5)9-4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11)
InChIKeyXBDIVKWPKGCLKB-UHFFFAOYSA-N
MW184.22 g/mol
LogP1.42
Rot. Bonds3

About 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid

2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 54595590) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid
PubChem CID54595590
Molecular FormulaC7H8N2O2S
Molecular Weight184.22 g/mol
Exact Mass184.03
IUPAC Name2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(NC2CC2)s1
InChIInChI=1S/C7H8N2O2S/c10-6(11)5-3-8-7(12-5)9-4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11)
InChIKeyXBDIVKWPKGCLKB-UHFFFAOYSA-N
XLogP1.42
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.22
LogP ≤ 51.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid (CID 54595590) is 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(NC2CC2)s1.
What is the InChIKey of 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is XBDIVKWPKGCLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c10-6(11)5-3-8-7(12-5)9-4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11).
What are the key properties of 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid?
2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 184.22 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylamino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 54595590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).