About 5-(1-chloroethyl)-1,2,4-oxadiazole
5-(1-chloroethyl)-1,2,4-oxadiazole (PubChem CID 54595653) has the molecular formula C4H5ClN2O
and a molecular weight of 132.55 g/mol. Its IUPAC name is 5-(1-chloroethyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-(1-chloroethyl)-1,2,4-oxadiazole |
| PubChem CID | 54595653 |
| Molecular Formula | C4H5ClN2O |
| Molecular Weight | 132.55 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | 5-(1-chloroethyl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1ncno1 |
| InChI | InChI=1S/C4H5ClN2O/c1-3(5)4-6-2-7-8-4/h2-3H,1H3 |
| InChIKey | VSIPORBCZAHKKW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-chloroethyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-chloroethyl)-1,2,4-oxadiazole?
The IUPAC name of 5-(1-chloroethyl)-1,2,4-oxadiazole (CID 54595653) is 5-(1-chloroethyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-(1-chloroethyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-(1-chloroethyl)-1,2,4-oxadiazole is CC(Cl)c1ncno1.
What is the InChIKey of 5-(1-chloroethyl)-1,2,4-oxadiazole?
The InChIKey is VSIPORBCZAHKKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2O/c1-3(5)4-6-2-7-8-4/h2-3H,1H3.
What are the key properties of 5-(1-chloroethyl)-1,2,4-oxadiazole?
5-(1-chloroethyl)-1,2,4-oxadiazole has a molecular weight of 132.55 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-chloroethyl)-1,2,4-oxadiazole is sourced from PubChem (CID 54595653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).