About 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid
3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 54595665) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid |
| PubChem CID | 54595665 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-n1cncn1 |
| InChI | InChI=1S/C10H9N3O2/c1-7-4-8(10(14)15)2-3-9(7)13-6-11-5-12-13/h2-6H,1H3,(H,14,15) |
| InChIKey | YUXYIVAMDIVYBL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid?
The IUPAC name of 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid (CID 54595665) is 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid.
What is the SMILES notation for 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid?
The canonical SMILES for 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid is Cc1cc(C(=O)O)ccc1-n1cncn1.
What is the InChIKey of 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid?
The InChIKey is YUXYIVAMDIVYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-7-4-8(10(14)15)2-3-9(7)13-6-11-5-12-13/h2-6H,1H3,(H,14,15).
What are the key properties of 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid?
3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid has a molecular weight of 203.20 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(1,2,4-triazol-1-yl)benzoic acid is sourced from PubChem (CID 54595665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).