About 2-(chloromethyl)-5-ethyl-1,3-oxazole
2-(chloromethyl)-5-ethyl-1,3-oxazole (PubChem CID 54595701) has the molecular formula C6H8ClNO
and a molecular weight of 145.59 g/mol. Its IUPAC name is 2-(chloromethyl)-5-ethyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(chloromethyl)-5-ethyl-1,3-oxazole |
| PubChem CID | 54595701 |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 2-(chloromethyl)-5-ethyl-1,3-oxazole |
| SMILES | CCc1cnc(CCl)o1 |
| InChI | InChI=1S/C6H8ClNO/c1-2-5-4-8-6(3-7)9-5/h4H,2-3H2,1H3 |
| InChIKey | OGHORSYJZJMPIZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-5-ethyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-5-ethyl-1,3-oxazole?
The IUPAC name of 2-(chloromethyl)-5-ethyl-1,3-oxazole (CID 54595701) is 2-(chloromethyl)-5-ethyl-1,3-oxazole.
What is the SMILES notation for 2-(chloromethyl)-5-ethyl-1,3-oxazole?
The canonical SMILES for 2-(chloromethyl)-5-ethyl-1,3-oxazole is CCc1cnc(CCl)o1.
What is the InChIKey of 2-(chloromethyl)-5-ethyl-1,3-oxazole?
The InChIKey is OGHORSYJZJMPIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNO/c1-2-5-4-8-6(3-7)9-5/h4H,2-3H2,1H3.
What are the key properties of 2-(chloromethyl)-5-ethyl-1,3-oxazole?
2-(chloromethyl)-5-ethyl-1,3-oxazole has a molecular weight of 145.59 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-5-ethyl-1,3-oxazole is sourced from PubChem (CID 54595701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).