C12H13N3 — CID 54595801
3-pyrazol-1-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 54595801) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-pyrazol-1-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-pyrazol-1-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 54595801 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-pyrazol-1-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CC(n1cccn1)CN2 |
| InChI | InChI=1S/C12H13N3/c1-2-5-12-10(4-1)8-11(9-13-12)15-7-3-6-14-15/h1-7,11,13H,8-9H2 |
| InChIKey | CATQCGCHENXPMP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |