About 1-oxothiolan-3-amine;hydrochloride
1-oxothiolan-3-amine;hydrochloride (PubChem CID 54595889) has the molecular formula C4H10ClNOS
and a molecular weight of 155.65 g/mol. Its IUPAC name is 1-oxothiolan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-oxothiolan-3-amine;hydrochloride |
| PubChem CID | 54595889 |
| Molecular Formula | C4H10ClNOS |
| Molecular Weight | 155.65 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | 1-oxothiolan-3-amine;hydrochloride |
| SMILES | Cl.NC1CCS(=O)C1 |
| InChI | InChI=1S/C4H9NOS.ClH/c5-4-1-2-7(6)3-4;/h4H,1-3,5H2;1H |
| InChIKey | XZMMMJCHVCJRNZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.65 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxothiolan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxothiolan-3-amine;hydrochloride?
The IUPAC name of 1-oxothiolan-3-amine;hydrochloride (CID 54595889) is 1-oxothiolan-3-amine;hydrochloride.
What is the SMILES notation for 1-oxothiolan-3-amine;hydrochloride?
The canonical SMILES for 1-oxothiolan-3-amine;hydrochloride is Cl.NC1CCS(=O)C1.
What is the InChIKey of 1-oxothiolan-3-amine;hydrochloride?
The InChIKey is XZMMMJCHVCJRNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOS.ClH/c5-4-1-2-7(6)3-4;/h4H,1-3,5H2;1H.
What are the key properties of 1-oxothiolan-3-amine;hydrochloride?
1-oxothiolan-3-amine;hydrochloride has a molecular weight of 155.65 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxothiolan-3-amine;hydrochloride is sourced from PubChem (CID 54595889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).