C6H16Cl2N2OS — CID 54595991
2-(1-oxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride (PubChem CID 54595991) has the molecular formula C6H16Cl2N2OS and a molecular weight of 235.18 g/mol. Its IUPAC name is 2-(1-oxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride.
| Compound Name | 2-(1-oxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 54595991 |
| Molecular Formula | C6H16Cl2N2OS |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2-(1-oxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCN1CCS(=O)CC1 |
| InChI | InChI=1S/C6H14N2OS.2ClH/c7-1-2-8-3-5-10(9)6-4-8;;/h1-7H2;2*1H |
| InChIKey | FBBPFOCASNKIAF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |