C23H22Cl2FN5 — CID 54596150
1-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine (PubChem CID 54596150) has the molecular formula C23H22Cl2FN5 and a molecular weight of 458.37 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 54596150 |
| Molecular Formula | C23H22Cl2FN5 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine |
| SMILES | C[C@H](c1c(Cl)ccc(F)c1Cl)n1ccc2ncc(-c3cnn(C4CCNCC4)c3)cc21 |
| InChI | InChI=1S/C23H22Cl2FN5/c1-14(22-18(24)2-3-19(26)23(22)25)30-9-6-20-21(30)10-15(11-28-20)16-12-29-31(13-16)17-4-7-27-8-5-17/h2-3,6,9-14,17,27H,4-5,7-8H2,1H3/t14-/m1/s1 |
| InChIKey | DLGPYOKGGWXLHS-CQSZACIVSA-N |
| XLogP | 5.88 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|