C17H21N9O3 — CID 54596158
2-(2-aminopyrimidin-5-yl)-N-(2-methoxyethyl)-4-morpholin-4-ylimidazo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 54596158) has the molecular formula C17H21N9O3 and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-5-yl)-N-(2-methoxyethyl)-4-morpholin-4-ylimidazo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 2-(2-aminopyrimidin-5-yl)-N-(2-methoxyethyl)-4-morpholin-4-ylimidazo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 54596158 |
| Molecular Formula | C17H21N9O3 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-(2-aminopyrimidin-5-yl)-N-(2-methoxyethyl)-4-morpholin-4-ylimidazo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | COCCNC(=O)c1cn2nc(-c3cnc(N)nc3)nc(N3CCOCC3)c2n1 |
| InChI | InChI=1S/C17H21N9O3/c1-28-5-2-19-16(27)12-10-26-15(22-12)14(25-3-6-29-7-4-25)23-13(24-26)11-8-20-17(18)21-9-11/h8-10H,2-7H2,1H3,(H,19,27)(H2,18,20,21) |
| InChIKey | LKIIHGHLBOJBRR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|