C23H35BO3 — CID 54596260
(2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]heptan-1-ol (PubChem CID 54596260) has the molecular formula C23H35BO3 and a molecular weight of 370.34 g/mol. Its IUPAC name is (2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]heptan-1-ol.
| Compound Name | (2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]heptan-1-ol |
|---|---|
| PubChem CID | 54596260 |
| Molecular Formula | C23H35BO3 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]heptan-1-ol |
| SMILES | CCCCC/C(=C\B1OC(C)(C)C(C)(C)O1)C(O)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C23H35BO3/c1-6-7-9-14-20(17-24-26-21(2,3)22(4,5)27-24)23(25,19-15-16-19)18-12-10-8-11-13-18/h8,10-13,17,19,25H,6-7,9,14-16H2,1-5H3/b20-17+ |
| InChIKey | XSNZEINWEKUKHC-LVZFUZTISA-N |
| XLogP | 5.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|