About 4-(bromomethyl)heptane
4-(bromomethyl)heptane (PubChem CID 545964) has the molecular formula C8H17Br
and a molecular weight of 193.13 g/mol. Its IUPAC name is 4-(bromomethyl)heptane.
Molecular Properties
| Compound Name | 4-(bromomethyl)heptane |
| PubChem CID | 545964 |
| Molecular Formula | C8H17Br |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-(bromomethyl)heptane |
| SMILES | CCCC(CBr)CCC |
| InChI | InChI=1S/C8H17Br/c1-3-5-8(7-9)6-4-2/h8H,3-7H2,1-2H3 |
| InChIKey | ZVWCWXUOSBDXEQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)heptane?
The IUPAC name of 4-(bromomethyl)heptane (CID 545964) is 4-(bromomethyl)heptane.
What is the SMILES notation for 4-(bromomethyl)heptane?
The canonical SMILES for 4-(bromomethyl)heptane is CCCC(CBr)CCC.
What is the InChIKey of 4-(bromomethyl)heptane?
The InChIKey is ZVWCWXUOSBDXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Br/c1-3-5-8(7-9)6-4-2/h8H,3-7H2,1-2H3.
What are the key properties of 4-(bromomethyl)heptane?
4-(bromomethyl)heptane has a molecular weight of 193.13 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)heptane is sourced from PubChem (CID 545964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).