C30H32FNO5 — CID 54596409
4-[[4-carboxybutyl-[8-[(3-fluorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]benzoic acid (PubChem CID 54596409) has the molecular formula C30H32FNO5 and a molecular weight of 505.59 g/mol. Its IUPAC name is 4-[[4-carboxybutyl-[8-[(3-fluorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-carboxybutyl-[8-[(3-fluorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 54596409 |
| Molecular Formula | C30H32FNO5 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 4-[[4-carboxybutyl-[8-[(3-fluorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)CCCCN(Cc1ccc(C(=O)O)cc1)C1CCc2cccc(OCc3cccc(F)c3)c2C1 |
| InChI | InChI=1S/C30H32FNO5/c31-25-7-3-5-22(17-25)20-37-28-8-4-6-23-14-15-26(18-27(23)28)32(16-2-1-9-29(33)34)19-21-10-12-24(13-11-21)30(35)36/h3-8,10-13,17,26H,1-2,9,14-16,18-20H2,(H,33,34)(H,35,36) |
| InChIKey | ZZRLVDHXAHKPLD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|