C37H41FN6O4 — CID 54596455
2-[5-fluoro-2-(hydroxymethyl)-3-[4-methyl-6-[4-[1-(oxetan-3-yl)piperidin-4-yl]anilino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 54596455) has the molecular formula C37H41FN6O4 and a molecular weight of 652.77 g/mol. Its IUPAC name is 2-[5-fluoro-2-(hydroxymethyl)-3-[4-methyl-6-[4-[1-(oxetan-3-yl)piperidin-4-yl]anilino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[5-fluoro-2-(hydroxymethyl)-3-[4-methyl-6-[4-[1-(oxetan-3-yl)piperidin-4-yl]anilino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 54596455 |
| Molecular Formula | C37H41FN6O4 |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | 2-[5-fluoro-2-(hydroxymethyl)-3-[4-methyl-6-[4-[1-(oxetan-3-yl)piperidin-4-yl]anilino]-5-oxopyrazin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | Cn1cc(-c2cc(F)cc(N3CCn4c(cc5c4CCCC5)C3=O)c2CO)nc(Nc2ccc(C3CCN(C4COC4)CC3)cc2)c1=O |
| InChI | InChI=1S/C37H41FN6O4/c1-41-19-31(40-35(37(41)47)39-27-8-6-23(7-9-27)24-10-12-42(13-11-24)28-21-48-22-28)29-17-26(38)18-33(30(29)20-45)44-15-14-43-32-5-3-2-4-25(32)16-34(43)36(44)46/h6-9,16-19,24,28,45H,2-5,10-15,20-22H2,1H3,(H,39,40) |
| InChIKey | FDVOHNAGTLPCTJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |