C23H35FO2 — CID 54596714
(1'S,2'R,10'aR,12'aS)-1'-fluoro-2',10'a,12'a-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,4a,4b,5,7,9,10,10b,11,12-dodecahydro-1H-chrysene] (PubChem CID 54596714) has the molecular formula C23H35FO2 and a molecular weight of 362.53 g/mol. Its IUPAC name is (1'S,2'R,10'aR,12'aS)-1'-fluoro-2',10'a,12'a-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,4a,4b,5,7,9,10,10b,11,12-dodecahydro-1H-chrysene].
| Compound Name | (1'S,2'R,10'aR,12'aS)-1'-fluoro-2',10'a,12'a-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,4a,4b,5,7,9,10,10b,11,12-dodecahydro-1H-chrysene] |
|---|---|
| PubChem CID | 54596714 |
| Molecular Formula | C23H35FO2 |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1'S,2'R,10'aR,12'aS)-1'-fluoro-2',10'a,12'a-trimethylspiro[1,3-dioxolane-2,8'-2,3,4,4a,4b,5,7,9,10,10b,11,12-dodecahydro-1H-chrysene] |
| SMILES | C[C@@H]1CCC2C3CC=C4CC5(CC[C@]4(C)C3CC[C@]2(C)[C@H]1F)OCCO5 |
| InChI | InChI=1S/C23H35FO2/c1-15-4-7-18-17-6-5-16-14-23(25-12-13-26-23)11-10-21(16,2)19(17)8-9-22(18,3)20(15)24/h5,15,17-20H,4,6-14H2,1-3H3/t15-,17?,18?,19?,20+,21+,22+/m1/s1 |
| InChIKey | BPKDOUXIMRGMTN-HNWWLQPFSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|