C33H37N7O3 — CID 54596802
2-[2-(hydroxymethyl)-3-[1-methyl-6-oxo-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-3-pyridinyl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 54596802) has the molecular formula C33H37N7O3 and a molecular weight of 579.71 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-3-[1-methyl-6-oxo-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-3-pyridinyl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[2-(hydroxymethyl)-3-[1-methyl-6-oxo-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-3-pyridinyl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 54596802 |
| Molecular Formula | C33H37N7O3 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 2-[2-(hydroxymethyl)-3-[1-methyl-6-oxo-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-3-pyridinyl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | Cn1cc(-c2cccc(N3CCn4c(cc5c4CCCC5)C3=O)c2CO)cc(Nc2ccc(N3CCNCC3)cn2)c1=O |
| InChI | InChI=1S/C33H37N7O3/c1-37-20-23(17-27(32(37)42)36-31-10-9-24(19-35-31)38-13-11-34-12-14-38)25-6-4-8-29(26(25)21-41)40-16-15-39-28-7-3-2-5-22(28)18-30(39)33(40)43/h4,6,8-10,17-20,34,41H,2-3,5,7,11-16,21H2,1H3,(H,35,36) |
| InChIKey | ONJPKQLOZFKBFJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |