C35H41N7O3 — CID 54596876
2-[3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-2-(hydroxymethyl)phenyl]-3,4,6,7,8,9-hexahydropyrido[3,4-b]indolizin-1-one (PubChem CID 54596876) has the molecular formula C35H41N7O3 and a molecular weight of 607.76 g/mol. Its IUPAC name is 2-[3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-2-(hydroxymethyl)phenyl]-3,4,6,7,8,9-hexahydropyrido[3,4-b]indolizin-1-one.
| Compound Name | 2-[3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-2-(hydroxymethyl)phenyl]-3,4,6,7,8,9-hexahydropyrido[3,4-b]indolizin-1-one |
|---|---|
| PubChem CID | 54596876 |
| Molecular Formula | C35H41N7O3 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | 2-[3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-2-(hydroxymethyl)phenyl]-3,4,6,7,8,9-hexahydropyrido[3,4-b]indolizin-1-one |
| SMILES | CCN1CCN(c2ccc(Nc3cc(-c4cccc(N5CCc6c(cc7n6CCCC7)C5=O)c4CO)cn(C)c3=O)nc2)CC1 |
| InChI | InChI=1S/C35H41N7O3/c1-3-39-15-17-40(18-16-39)26-10-11-33(36-21-26)37-30-19-24(22-38(2)35(30)45)27-8-6-9-31(29(27)23-43)42-14-12-32-28(34(42)44)20-25-7-4-5-13-41(25)32/h6,8-11,19-22,43H,3-5,7,12-18,23H2,1-2H3,(H,36,37) |
| InChIKey | JFQBPTJMPIWHRT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |