About 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide
1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide (PubChem CID 5459707) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide |
| PubChem CID | 5459707 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide |
| SMILES | CNC(=O)C1(C)C=CC2(CCCCC2)N1C(C)=O |
| InChI | InChI=1S/C14H22N2O2/c1-11(17)16-13(2,12(18)15-3)9-10-14(16)7-5-4-6-8-14/h9-10H,4-8H2,1-3H3,(H,15,18) |
| InChIKey | JOCLDERNCXRSGO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide?
The IUPAC name of 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide (CID 5459707) is 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide.
What is the SMILES notation for 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide?
The canonical SMILES for 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide is CNC(=O)C1(C)C=CC2(CCCCC2)N1C(C)=O.
What is the InChIKey of 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide?
The InChIKey is JOCLDERNCXRSGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-11(17)16-13(2,12(18)15-3)9-10-14(16)7-5-4-6-8-14/h9-10H,4-8H2,1-3H3,(H,15,18).
What are the key properties of 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide?
1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide has a molecular weight of 250.34 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N,2-dimethyl-1-azaspiro[4.5]dec-3-ene-2-carboxamide is sourced from PubChem (CID 5459707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).