About dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate
dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate (PubChem CID 5459719) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate |
| PubChem CID | 5459719 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate |
| SMILES | COC(=O)N1[C@H](C)C=C[C@]1(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H19NO4/c1-12-9-10-16(14(18)20-2,17(12)15(19)21-3)11-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3/t12-,16+/m1/s1 |
| InChIKey | RBMLINUVZGGVIR-WBMJQRKESA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate?
The IUPAC name of dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate (CID 5459719) is dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate.
What is the SMILES notation for dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate?
The canonical SMILES for dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate is COC(=O)N1[C@H](C)C=C[C@]1(Cc1ccccc1)C(=O)OC.
What is the InChIKey of dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate?
The InChIKey is RBMLINUVZGGVIR-WBMJQRKESA-N. The full InChI is InChI=1S/C16H19NO4/c1-12-9-10-16(14(18)20-2,17(12)15(19)21-3)11-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3/t12-,16+/m1/s1.
What are the key properties of dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate?
dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate has a molecular weight of 289.33 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2R,5R)-5-benzyl-2-methyl-2H-pyrrole-1,5-dicarboxylate is sourced from PubChem (CID 5459719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).