C15H17NO3 — CID 5459721
(2R,5R)-1-acetyl-5-benzyl-2-methyl-2H-pyrrole-5-carboxylic acid (PubChem CID 5459721) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is (2R,5R)-1-acetyl-5-benzyl-2-methyl-2H-pyrrole-5-carboxylic acid.
| Compound Name | (2R,5R)-1-acetyl-5-benzyl-2-methyl-2H-pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 5459721 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R,5R)-1-acetyl-5-benzyl-2-methyl-2H-pyrrole-5-carboxylic acid |
| SMILES | CC(=O)N1[C@H](C)C=C[C@]1(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H17NO3/c1-11-8-9-15(14(18)19,16(11)12(2)17)10-13-6-4-3-5-7-13/h3-9,11H,10H2,1-2H3,(H,18,19)/t11-,15+/m1/s1 |
| InChIKey | LAYFCLYEMCJTRA-ABAIWWIYSA-N |
| XLogP | 1.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|