C15H20N2O4 — CID 54597431
(3S,6S)-3-benzyl-3,6-dihydroxy-6-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 54597431) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3S,6S)-3-benzyl-3,6-dihydroxy-6-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | (3S,6S)-3-benzyl-3,6-dihydroxy-6-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 54597431 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (3S,6S)-3-benzyl-3,6-dihydroxy-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)C[C@@]1(O)NC(=O)[C@@](O)(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C15H20N2O4/c1-10(2)8-14(20)12(18)17-15(21,13(19)16-14)9-11-6-4-3-5-7-11/h3-7,10,20-21H,8-9H2,1-2H3,(H,16,19)(H,17,18)/t14-,15-/m0/s1 |
| InChIKey | BFFIQSKYESGUSO-GJZGRUSLSA-N |
| XLogP | -0.10 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |